C25H30N5O8P — CID 136953898
2-amino-9-[2-[[(5-cyclopentyl-2-oxo-1,3-dioxol-4-yl)methoxy-[(4-methylphenyl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 136953898) has the molecular formula C25H30N5O8P and a molecular weight of 559.52 g/mol. Its IUPAC name is 2-amino-9-[2-[[(5-cyclopentyl-2-oxo-1,3-dioxol-4-yl)methoxy-[(4-methylphenyl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(5-cyclopentyl-2-oxo-1,3-dioxol-4-yl)methoxy-[(4-methylphenyl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953898 |
| Molecular Formula | C25H30N5O8P |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 2-amino-9-[2-[[(5-cyclopentyl-2-oxo-1,3-dioxol-4-yl)methoxy-[(4-methylphenyl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | Cc1ccc(COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCc2oc(=O)oc2C2CCCC2)cc1 |
| InChI | InChI=1S/C25H30N5O8P/c1-16-6-8-17(9-7-16)12-35-39(33,36-13-19-21(38-25(32)37-19)18-4-2-3-5-18)15-34-11-10-30-14-27-20-22(30)28-24(26)29-23(20)31/h6-9,14,18H,2-5,10-13,15H2,1H3,(H3,26,28,29,31) |
| InChIKey | NNNAAHIMQIHNPM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 177.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|