C26H25BrN5O8P — CID 137014056
2-amino-9-[2-[[(3-bromophenyl)methoxy-[[5-(4-methylphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 137014056) has the molecular formula C26H25BrN5O8P and a molecular weight of 646.39 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-bromophenyl)methoxy-[[5-(4-methylphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-bromophenyl)methoxy-[[5-(4-methylphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137014056 |
| Molecular Formula | C26H25BrN5O8P |
| Molecular Weight | 646.39 g/mol |
| Exact Mass | 645.06 |
| IUPAC Name | 2-amino-9-[2-[[(3-bromophenyl)methoxy-[[5-(4-methylphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | Cc1ccc(-c2oc(=O)oc2COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C26H25BrN5O8P/c1-16-5-7-18(8-6-16)22-20(39-26(34)40-22)13-38-41(35,37-12-17-3-2-4-19(27)11-17)15-36-10-9-32-14-29-21-23(32)30-25(28)31-24(21)33/h2-8,11,14H,9-10,12-13,15H2,1H3,(H3,28,30,31,33) |
| InChIKey | RDUMBQPNTVNQOY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 177.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|