C19H19BrN5O8P — CID 137014482
2-amino-9-[2-[[(3-bromophenyl)methoxy-[(2-oxo-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 137014482) has the molecular formula C19H19BrN5O8P and a molecular weight of 556.27 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-bromophenyl)methoxy-[(2-oxo-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-bromophenyl)methoxy-[(2-oxo-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137014482 |
| Molecular Formula | C19H19BrN5O8P |
| Molecular Weight | 556.27 g/mol |
| Exact Mass | 555.02 |
| IUPAC Name | 2-amino-9-[2-[[(3-bromophenyl)methoxy-[(2-oxo-1,3-dioxol-4-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCOCP(=O)(OCc2cccc(Br)c2)OCc2coc(=O)o2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H19BrN5O8P/c20-13-3-1-2-12(6-13)7-31-34(28,32-9-14-8-30-19(27)33-14)11-29-5-4-25-10-22-15-16(25)23-18(21)24-17(15)26/h1-3,6,8,10H,4-5,7,9,11H2,(H3,21,23,24,26) |
| InChIKey | FVOGVHBFLVFBMY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 177.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|