C25H27BrN5O7P — CID 137014188
2-amino-9-[2-[2-[(3-bromophenyl)methoxy-[2-(4-methoxyphenyl)-2-oxoethoxy]phosphoryl]ethoxy]ethyl]-1H-purin-6-one (PubChem CID 137014188) has the molecular formula C25H27BrN5O7P and a molecular weight of 620.40 g/mol. Its IUPAC name is 2-amino-9-[2-[2-[(3-bromophenyl)methoxy-[2-(4-methoxyphenyl)-2-oxoethoxy]phosphoryl]ethoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[2-[(3-bromophenyl)methoxy-[2-(4-methoxyphenyl)-2-oxoethoxy]phosphoryl]ethoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137014188 |
| Molecular Formula | C25H27BrN5O7P |
| Molecular Weight | 620.40 g/mol |
| Exact Mass | 619.08 |
| IUPAC Name | 2-amino-9-[2-[2-[(3-bromophenyl)methoxy-[2-(4-methoxyphenyl)-2-oxoethoxy]phosphoryl]ethoxy]ethyl]-1H-purin-6-one |
| SMILES | COc1ccc(C(=O)COP(=O)(CCOCCn2cnc3c(=O)[nH]c(N)nc32)OCc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C25H27BrN5O7P/c1-35-20-7-5-18(6-8-20)21(32)15-38-39(34,37-14-17-3-2-4-19(26)13-17)12-11-36-10-9-31-16-28-22-23(31)29-25(27)30-24(22)33/h2-8,13,16H,9-12,14-15H2,1H3,(H3,27,29,30,33) |
| InChIKey | QUVQXLQRHOKDCX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|