C24H26N5O6P — CID 136953845
2-amino-9-[2-[2-[phenacyloxy(phenylmethoxy)phosphoryl]ethoxy]ethyl]-1H-purin-6-one (PubChem CID 136953845) has the molecular formula C24H26N5O6P and a molecular weight of 511.48 g/mol. Its IUPAC name is 2-amino-9-[2-[2-[phenacyloxy(phenylmethoxy)phosphoryl]ethoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[2-[phenacyloxy(phenylmethoxy)phosphoryl]ethoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953845 |
| Molecular Formula | C24H26N5O6P |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 2-amino-9-[2-[2-[phenacyloxy(phenylmethoxy)phosphoryl]ethoxy]ethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCOCCP(=O)(OCC(=O)c2ccccc2)OCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H26N5O6P/c25-24-27-22-21(23(31)28-24)26-17-29(22)11-12-33-13-14-36(32,34-15-18-7-3-1-4-8-18)35-16-20(30)19-9-5-2-6-10-19/h1-10,17H,11-16H2,(H3,25,27,28,31) |
| InChIKey | UVZPVCYKFYQION-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|