C25H27FN5O6P — CID 136953855
2-amino-9-[2-[2-[(3-fluorophenyl)methoxy-[2-(4-methylphenyl)-2-oxoethoxy]phosphoryl]ethoxy]ethyl]-1H-purin-6-one (PubChem CID 136953855) has the molecular formula C25H27FN5O6P and a molecular weight of 543.49 g/mol. Its IUPAC name is 2-amino-9-[2-[2-[(3-fluorophenyl)methoxy-[2-(4-methylphenyl)-2-oxoethoxy]phosphoryl]ethoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[2-[(3-fluorophenyl)methoxy-[2-(4-methylphenyl)-2-oxoethoxy]phosphoryl]ethoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953855 |
| Molecular Formula | C25H27FN5O6P |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | 2-amino-9-[2-[2-[(3-fluorophenyl)methoxy-[2-(4-methylphenyl)-2-oxoethoxy]phosphoryl]ethoxy]ethyl]-1H-purin-6-one |
| SMILES | Cc1ccc(C(=O)COP(=O)(CCOCCn2cnc3c(=O)[nH]c(N)nc32)OCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C25H27FN5O6P/c1-17-5-7-19(8-6-17)21(32)15-37-38(34,36-14-18-3-2-4-20(26)13-18)12-11-35-10-9-31-16-28-22-23(31)29-25(27)30-24(22)33/h2-8,13,16H,9-12,14-15H2,1H3,(H3,27,29,30,33) |
| InChIKey | GUZXBBHVDOQMCI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|