C20H26FN6O5P — CID 159692408
2-amino-9-[2-[[(3-fluorophenyl)methoxy-[(2-methyl-3-oxobutan-2-yl)amino]phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 159692408) has the molecular formula C20H26FN6O5P and a molecular weight of 480.44 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-fluorophenyl)methoxy-[(2-methyl-3-oxobutan-2-yl)amino]phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-fluorophenyl)methoxy-[(2-methyl-3-oxobutan-2-yl)amino]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 159692408 |
| Molecular Formula | C20H26FN6O5P |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-amino-9-[2-[[(3-fluorophenyl)methoxy-[(2-methyl-3-oxobutan-2-yl)amino]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | CC(=O)C(C)(C)NP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1cccc(F)c1 |
| InChI | InChI=1S/C20H26FN6O5P/c1-13(28)20(2,3)26-33(30,32-10-14-5-4-6-15(21)9-14)12-31-8-7-27-11-23-16-17(27)24-19(22)25-18(16)29/h4-6,9,11H,7-8,10,12H2,1-3H3,(H,26,30)(H3,22,24,25,29) |
| InChIKey | FOTTVDJTFVADPQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|