C22H29FN5O5PS — CID 145045857
S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 145045857) has the molecular formula C22H29FN5O5PS and a molecular weight of 525.54 g/mol. Its IUPAC name is S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 145045857 |
| Molecular Formula | C22H29FN5O5PS |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1cccc(F)c1 |
| InChI | InChI=1S/C22H29FN5O5PS/c1-22(2,3)20(30)35-10-9-32-34(33-12-15-5-4-6-16(23)11-15)14-31-8-7-28-13-25-17-18(28)26-21(24)27-19(17)29/h4-6,11,13H,7-10,12,14H2,1-3H3,(H3,24,26,27,29) |
| InChIKey | HTOQBOPFJDFNBJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|