C23H22F2N5O7P — CID 145045864
[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxymethyl (4-fluorophenyl) carbonate (PubChem CID 145045864) has the molecular formula C23H22F2N5O7P and a molecular weight of 549.43 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxymethyl (4-fluorophenyl) carbonate.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxymethyl (4-fluorophenyl) carbonate |
|---|---|
| PubChem CID | 145045864 |
| Molecular Formula | C23H22F2N5O7P |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxymethyl (4-fluorophenyl) carbonate |
| SMILES | Nc1nc2c(ncn2CCOCP(OCOC(=O)Oc2ccc(F)cc2)OCc2cccc(F)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C23H22F2N5O7P/c24-16-4-6-18(7-5-16)37-23(32)34-13-36-38(35-11-15-2-1-3-17(25)10-15)14-33-9-8-30-12-27-19-20(30)28-22(26)29-21(19)31/h1-7,10,12H,8-9,11,13-14H2,(H3,26,28,29,31) |
| InChIKey | DZMGJSJOVWBPFG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|