C20H23ClN5O5P — CID 145046038
2-amino-9-[2-[[(3-chlorophenyl)methoxy-(2-oxopent-4-enoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 145046038) has the molecular formula C20H23ClN5O5P and a molecular weight of 479.86 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-chlorophenyl)methoxy-(2-oxopent-4-enoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-chlorophenyl)methoxy-(2-oxopent-4-enoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 145046038 |
| Molecular Formula | C20H23ClN5O5P |
| Molecular Weight | 479.86 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-amino-9-[2-[[(3-chlorophenyl)methoxy-(2-oxopent-4-enoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | C=CCC(=O)COP(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H23ClN5O5P/c1-2-4-16(27)11-31-32(30-10-14-5-3-6-15(21)9-14)13-29-8-7-26-12-23-17-18(26)24-20(22)25-19(17)28/h2-3,5-6,9,12H,1,4,7-8,10-11,13H2,(H3,22,24,25,28) |
| InChIKey | SEQHJAWYLQPEFX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|