C23H23ClN5O5P — CID 145046158
2-amino-9-[2-[[(3-chlorophenyl)methoxy-phenacyloxyphosphanyl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 145046158) has the molecular formula C23H23ClN5O5P and a molecular weight of 515.89 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-chlorophenyl)methoxy-phenacyloxyphosphanyl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-chlorophenyl)methoxy-phenacyloxyphosphanyl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 145046158 |
| Molecular Formula | C23H23ClN5O5P |
| Molecular Weight | 515.89 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 2-amino-9-[2-[[(3-chlorophenyl)methoxy-phenacyloxyphosphanyl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCOCP(OCC(=O)c2ccccc2)OCc2cccc(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C23H23ClN5O5P/c24-18-8-4-5-16(11-18)12-33-35(34-13-19(30)17-6-2-1-3-7-17)15-32-10-9-29-14-26-20-21(29)27-23(25)28-22(20)31/h1-8,11,14H,9-10,12-13,15H2,(H3,25,27,28,31) |
| InChIKey | IMMGSDYRFSQADX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|