C24H24F2N5O6P — CID 145046153
2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-[2-(4-fluorophenyl)-2-oxoethoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 145046153) has the molecular formula C24H24F2N5O6P and a molecular weight of 547.46 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-[2-(4-fluorophenyl)-2-oxoethoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-[2-(4-fluorophenyl)-2-oxoethoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 145046153 |
| Molecular Formula | C24H24F2N5O6P |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-[2-(4-fluorophenyl)-2-oxoethoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | COc1ccc(COP(COCCn2cnc3c(=O)[nH]c(N)nc32)OCC(=O)c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C24H24F2N5O6P/c1-34-20-7-2-15(10-18(20)26)11-36-38(37-12-19(32)16-3-5-17(25)6-4-16)14-35-9-8-31-13-28-21-22(31)29-24(27)30-23(21)33/h2-7,10,13H,8-9,11-12,14H2,1H3,(H3,27,29,30,33) |
| InChIKey | GSFUIKBPZCNJGO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|