C26H26F2N5O6PS2 — CID 145045913
S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[2-(4-fluorobenzoyl)sulfanylethoxy]phosphanyl]oxyethyl] 4-fluorobenzenecarbothioate (PubChem CID 145045913) has the molecular formula C26H26F2N5O6PS2 and a molecular weight of 637.63 g/mol. Its IUPAC name is S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[2-(4-fluorobenzoyl)sulfanylethoxy]phosphanyl]oxyethyl] 4-fluorobenzenecarbothioate.
| Compound Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[2-(4-fluorobenzoyl)sulfanylethoxy]phosphanyl]oxyethyl] 4-fluorobenzenecarbothioate |
|---|---|
| PubChem CID | 145045913 |
| Molecular Formula | C26H26F2N5O6PS2 |
| Molecular Weight | 637.63 g/mol |
| Exact Mass | 637.10 |
| IUPAC Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[2-(4-fluorobenzoyl)sulfanylethoxy]phosphanyl]oxyethyl] 4-fluorobenzenecarbothioate |
| SMILES | Nc1nc2c(ncn2CCOCP(OCCSC(=O)c2ccc(F)cc2)OCCSC(=O)c2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C26H26F2N5O6PS2/c27-19-5-1-17(2-6-19)24(35)41-13-11-38-40(39-12-14-42-25(36)18-3-7-20(28)8-4-18)16-37-10-9-33-15-30-21-22(33)31-26(29)32-23(21)34/h1-8,15H,9-14,16H2,(H3,29,31,32,34) |
| InChIKey | XWVBMMQFCYKDBW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|