C27H32N5O6PS2 — CID 145045994
S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(2-methylsulfanylethoxy)phosphanyl]oxyethyl] benzenecarbothioate;benzaldehyde (PubChem CID 145045994) has the molecular formula C27H32N5O6PS2 and a molecular weight of 617.69 g/mol. Its IUPAC name is S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(2-methylsulfanylethoxy)phosphanyl]oxyethyl] benzenecarbothioate;benzaldehyde.
| Compound Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(2-methylsulfanylethoxy)phosphanyl]oxyethyl] benzenecarbothioate;benzaldehyde |
|---|---|
| PubChem CID | 145045994 |
| Molecular Formula | C27H32N5O6PS2 |
| Molecular Weight | 617.69 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-(2-methylsulfanylethoxy)phosphanyl]oxyethyl] benzenecarbothioate;benzaldehyde |
| SMILES | CSCCOP(COCCn1cnc2c(=O)[nH]c(N)nc21)OCCSC(=O)c1ccccc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C20H26N5O5PS2.C7H6O/c1-32-11-9-29-31(30-10-12-33-19(27)15-5-3-2-4-6-15)14-28-8-7-25-13-22-16-17(25)23-20(21)24-18(16)26;8-6-7-4-2-1-3-5-7/h2-6,13H,7-12,14H2,1H3,(H3,21,23,24,26);1-6H |
| InChIKey | VJIBXHTYXUAJGS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|