C20H27N6O5P — CID 167044524
ethyl (2S)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphanyl]amino]propanoate (PubChem CID 167044524) has the molecular formula C20H27N6O5P and a molecular weight of 462.45 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphanyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 167044524 |
| Molecular Formula | C20H27N6O5P |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | ethyl (2S)-2-[[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-phenylmethoxyphosphanyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1ccccc1 |
| InChI | InChI=1S/C20H27N6O5P/c1-3-30-19(28)14(2)25-32(31-11-15-7-5-4-6-8-15)13-29-10-9-26-12-22-16-17(26)23-20(21)24-18(16)27/h4-8,12,14,25H,3,9-11,13H2,1-2H3,(H3,21,23,24,27)/t14-,32?/m0/s1 |
| InChIKey | OKKUANFIDXNFOS-KFKHOZABSA-N |
| XLogP | 1.75 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|