C24H27N5O3 — CID 135671403
2-amino-9-[4-phenylmethoxy-3-(phenylmethoxymethyl)butyl]-1H-purin-6-one (PubChem CID 135671403) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-amino-9-[4-phenylmethoxy-3-(phenylmethoxymethyl)butyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[4-phenylmethoxy-3-(phenylmethoxymethyl)butyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135671403 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-amino-9-[4-phenylmethoxy-3-(phenylmethoxymethyl)butyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCC(COCc2ccccc2)COCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H27N5O3/c25-24-27-22-21(23(30)28-24)26-17-29(22)12-11-20(15-31-13-18-7-3-1-4-8-18)16-32-14-19-9-5-2-6-10-19/h1-10,17,20H,11-16H2,(H3,25,27,28,30) |
| InChIKey | UCPSARMKINLWCN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |