C8H9Br2N5O — CID 175411910
2-amino-9-(3,3-dibromopropyl)-1H-purin-6-one (PubChem CID 175411910) has the molecular formula C8H9Br2N5O and a molecular weight of 351.00 g/mol. Its IUPAC name is 2-amino-9-(3,3-dibromopropyl)-1H-purin-6-one.
| Compound Name | 2-amino-9-(3,3-dibromopropyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 175411910 |
| Molecular Formula | C8H9Br2N5O |
| Molecular Weight | 351.00 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | 2-amino-9-(3,3-dibromopropyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCC(Br)Br)c(=O)[nH]1 |
| InChI | InChI=1S/C8H9Br2N5O/c9-4(10)1-2-15-3-12-5-6(15)13-8(11)14-7(5)16/h3-4H,1-2H2,(H3,11,13,14,16) |
| InChIKey | CYNIUPXFAHMLIX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.00 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|