C7H11ClN6O — CID 162422020
2-amino-9-(2-aminoethyl)-1H-purin-6-one;hydrochloride (PubChem CID 162422020) has the molecular formula C7H11ClN6O and a molecular weight of 230.66 g/mol. Its IUPAC name is 2-amino-9-(2-aminoethyl)-1H-purin-6-one;hydrochloride.
| Compound Name | 2-amino-9-(2-aminoethyl)-1H-purin-6-one;hydrochloride |
|---|---|
| PubChem CID | 162422020 |
| Molecular Formula | C7H11ClN6O |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-amino-9-(2-aminoethyl)-1H-purin-6-one;hydrochloride |
| SMILES | Cl.NCCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C7H10N6O.ClH/c8-1-2-13-3-10-4-5(13)11-7(9)12-6(4)14;/h3H,1-2,8H2,(H3,9,11,12,14);1H |
| InChIKey | ZCIRWUUAJIDZMH-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |