C22H24N10O2 — CID 136682581
2-amino-9-[12-(2-amino-6-oxo-1H-purin-9-yl)dodeca-5,7-diynyl]-1H-purin-6-one (PubChem CID 136682581) has the molecular formula C22H24N10O2 and a molecular weight of 460.50 g/mol. Its IUPAC name is 2-amino-9-[12-(2-amino-6-oxo-1H-purin-9-yl)dodeca-5,7-diynyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[12-(2-amino-6-oxo-1H-purin-9-yl)dodeca-5,7-diynyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136682581 |
| Molecular Formula | C22H24N10O2 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-amino-9-[12-(2-amino-6-oxo-1H-purin-9-yl)dodeca-5,7-diynyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCCCC#CC#CCCCCn2cnc3c(=O)[nH]c(N)nc32)c(=O)[nH]1 |
| InChI | InChI=1S/C22H24N10O2/c23-21-27-17-15(19(33)29-21)25-13-31(17)11-9-7-5-3-1-2-4-6-8-10-12-32-14-26-16-18(32)28-22(24)30-20(16)34/h13-14H,5-12H2,(H3,23,27,29,33)(H3,24,28,30,34) |
| InChIKey | ZMAKXMMXWSVWQQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 179.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|