C9H12N5O4PS-2 — CID 172638073
2-amino-9-[3-(phosphonatomethylsulfanyl)propyl]-1H-purin-6-one (PubChem CID 172638073) has the molecular formula C9H12N5O4PS-2 and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-amino-9-[3-(phosphonatomethylsulfanyl)propyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[3-(phosphonatomethylsulfanyl)propyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 172638073 |
| Molecular Formula | C9H12N5O4PS-2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-amino-9-[3-(phosphonatomethylsulfanyl)propyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCCSCP(=O)([O-])[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N5O4PS/c10-9-12-7-6(8(15)13-9)11-4-14(7)2-1-3-20-5-19(16,17)18/h4H,1-3,5H2,(H2,16,17,18)(H3,10,12,13,15)/p-2 |
| InChIKey | CBIWJUXSISMYDP-UHFFFAOYSA-L |
| XLogP | -1.30 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|