C9H14N5O4PS — CID 155552605
3-(2-amino-6-oxo-1H-purin-9-yl)propylsulfanylmethylphosphonic acid (PubChem CID 155552605) has the molecular formula C9H14N5O4PS and a molecular weight of 319.28 g/mol. Its IUPAC name is 3-(2-amino-6-oxo-1H-purin-9-yl)propylsulfanylmethylphosphonic acid.
| Compound Name | 3-(2-amino-6-oxo-1H-purin-9-yl)propylsulfanylmethylphosphonic acid |
|---|---|
| PubChem CID | 155552605 |
| Molecular Formula | C9H14N5O4PS |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 3-(2-amino-6-oxo-1H-purin-9-yl)propylsulfanylmethylphosphonic acid |
| SMILES | Nc1nc2c(ncn2CCCSCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N5O4PS/c10-9-12-7-6(8(15)13-9)11-4-14(7)2-1-3-20-5-19(16,17)18/h4H,1-3,5H2,(H2,16,17,18)(H3,10,12,13,15) |
| InChIKey | CBIWJUXSISMYDP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|