C10H14N5O4P — CID 135416385
[(E)-5-(2-amino-6-oxo-1H-purin-9-yl)pent-3-enyl]phosphonic acid (PubChem CID 135416385) has the molecular formula C10H14N5O4P and a molecular weight of 299.23 g/mol. Its IUPAC name is [(E)-5-(2-amino-6-oxo-1H-purin-9-yl)pent-3-enyl]phosphonic acid.
| Compound Name | [(E)-5-(2-amino-6-oxo-1H-purin-9-yl)pent-3-enyl]phosphonic acid |
|---|---|
| PubChem CID | 135416385 |
| Molecular Formula | C10H14N5O4P |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | [(E)-5-(2-amino-6-oxo-1H-purin-9-yl)pent-3-enyl]phosphonic acid |
| SMILES | Nc1nc2c(ncn2C/C=C/CCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N5O4P/c11-10-13-8-7(9(16)14-10)12-6-15(8)4-2-1-3-5-20(17,18)19/h1-2,6H,3-5H2,(H2,17,18,19)(H3,11,13,14,16)/b2-1+ |
| InChIKey | XQMQEFXAYHQNGL-OWOJBTEDSA-N |
| XLogP | -0.17 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|