C10H13ClN5O3P — CID 88548050
[(Z)-5-(2-amino-6-chloropurin-9-yl)pent-3-enyl]phosphonic acid (PubChem CID 88548050) has the molecular formula C10H13ClN5O3P and a molecular weight of 317.67 g/mol. Its IUPAC name is [(Z)-5-(2-amino-6-chloropurin-9-yl)pent-3-enyl]phosphonic acid.
| Compound Name | [(Z)-5-(2-amino-6-chloropurin-9-yl)pent-3-enyl]phosphonic acid |
|---|---|
| PubChem CID | 88548050 |
| Molecular Formula | C10H13ClN5O3P |
| Molecular Weight | 317.67 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | [(Z)-5-(2-amino-6-chloropurin-9-yl)pent-3-enyl]phosphonic acid |
| SMILES | Nc1nc(Cl)c2ncn(C/C=C\CCP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C10H13ClN5O3P/c11-8-7-9(15-10(12)14-8)16(6-13-7)4-2-1-3-5-20(17,18)19/h1-2,6H,3-5H2,(H2,12,14,15)(H2,17,18,19)/b2-1- |
| InChIKey | BCIZAQMEBRAVHE-UPHRSURJSA-N |
| XLogP | 1.19 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.67 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|