C9H13N6O3P — CID 6474330
[(E)-4-(2,6-diaminopurin-9-yl)but-1-enyl]phosphonic acid (PubChem CID 6474330) has the molecular formula C9H13N6O3P and a molecular weight of 284.22 g/mol. Its IUPAC name is [(E)-4-(2,6-diaminopurin-9-yl)but-1-enyl]phosphonic acid.
| Compound Name | [(E)-4-(2,6-diaminopurin-9-yl)but-1-enyl]phosphonic acid |
|---|---|
| PubChem CID | 6474330 |
| Molecular Formula | C9H13N6O3P |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | [(E)-4-(2,6-diaminopurin-9-yl)but-1-enyl]phosphonic acid |
| SMILES | Nc1nc(N)c2ncn(CC/C=C/P(=O)(O)O)c2n1 |
| InChI | InChI=1S/C9H13N6O3P/c10-7-6-8(14-9(11)13-7)15(5-12-6)3-1-2-4-19(16,17)18/h2,4-5H,1,3H2,(H2,16,17,18)(H4,10,11,13,14)/b4-2+ |
| InChIKey | HTDBQGIUOZUYHF-DUXPYHPUSA-N |
| XLogP | 0.07 |
| TPSA | 153.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|