C11H17N6O4P — CID 68813433
3-[(2,6-diaminopurin-9-yl)methyl]but-3-en-2-yloxymethylphosphonic acid (PubChem CID 68813433) has the molecular formula C11H17N6O4P and a molecular weight of 328.27 g/mol. Its IUPAC name is 3-[(2,6-diaminopurin-9-yl)methyl]but-3-en-2-yloxymethylphosphonic acid.
| Compound Name | 3-[(2,6-diaminopurin-9-yl)methyl]but-3-en-2-yloxymethylphosphonic acid |
|---|---|
| PubChem CID | 68813433 |
| Molecular Formula | C11H17N6O4P |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 3-[(2,6-diaminopurin-9-yl)methyl]but-3-en-2-yloxymethylphosphonic acid |
| SMILES | C=C(Cn1cnc2c(N)nc(N)nc21)C(C)OCP(=O)(O)O |
| InChI | InChI=1S/C11H17N6O4P/c1-6(7(2)21-5-22(18,19)20)3-17-4-14-8-9(12)15-11(13)16-10(8)17/h4,7H,1,3,5H2,2H3,(H2,18,19,20)(H4,12,13,15,16) |
| InChIKey | PDIPEZWVZUQMRG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 162.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|