C10H16N5O5PS — CID 14555969
[1-(6-amino-2-methylsulfanylpurin-9-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid (PubChem CID 14555969) has the molecular formula C10H16N5O5PS and a molecular weight of 349.31 g/mol. Its IUPAC name is [1-(6-amino-2-methylsulfanylpurin-9-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid.
| Compound Name | [1-(6-amino-2-methylsulfanylpurin-9-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 14555969 |
| Molecular Formula | C10H16N5O5PS |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | [1-(6-amino-2-methylsulfanylpurin-9-yl)-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
| SMILES | CSc1nc(N)c2ncn(CC(CO)OCP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C10H16N5O5PS/c1-22-10-13-8(11)7-9(14-10)15(4-12-7)2-6(3-16)20-5-21(17,18)19/h4,6,16H,2-3,5H2,1H3,(H2,11,13,14)(H2,17,18,19) |
| InChIKey | MOJFNAMFZFXUNE-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|