C9H13N5O2S — CID 14035870
2-[(6-amino-2-methylsulfanylpurin-9-yl)methoxy]ethanol (PubChem CID 14035870) has the molecular formula C9H13N5O2S and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-[(6-amino-2-methylsulfanylpurin-9-yl)methoxy]ethanol.
| Compound Name | 2-[(6-amino-2-methylsulfanylpurin-9-yl)methoxy]ethanol |
|---|---|
| PubChem CID | 14035870 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-[(6-amino-2-methylsulfanylpurin-9-yl)methoxy]ethanol |
| SMILES | CSc1nc(N)c2ncn(COCCO)c2n1 |
| InChI | InChI=1S/C9H13N5O2S/c1-17-9-12-7(10)6-8(13-9)14(4-11-6)5-16-3-2-15/h4,15H,2-3,5H2,1H3,(H2,10,12,13) |
| InChIKey | DKMSOYHUWZVFIF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|