C9H11IN4O3 — CID 3011674
2-[(2-iodo-6-methoxypurin-9-yl)methoxy]ethanol (PubChem CID 3011674) has the molecular formula C9H11IN4O3 and a molecular weight of 350.12 g/mol. Its IUPAC name is 2-[(2-iodo-6-methoxypurin-9-yl)methoxy]ethanol.
| Compound Name | 2-[(2-iodo-6-methoxypurin-9-yl)methoxy]ethanol |
|---|---|
| PubChem CID | 3011674 |
| Molecular Formula | C9H11IN4O3 |
| Molecular Weight | 350.12 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 2-[(2-iodo-6-methoxypurin-9-yl)methoxy]ethanol |
| SMILES | COc1nc(I)nc2c1ncn2COCCO |
| InChI | InChI=1S/C9H11IN4O3/c1-16-8-6-7(12-9(10)13-8)14(4-11-6)5-17-3-2-15/h4,15H,2-3,5H2,1H3 |
| InChIKey | DJEBOLCBNYGRJE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.12 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|