C12H17N5O7 — CID 135753375
2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;butanedioic acid (PubChem CID 135753375) has the molecular formula C12H17N5O7 and a molecular weight of 343.30 g/mol. Its IUPAC name is 2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;butanedioic acid.
| Compound Name | 2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;butanedioic acid |
|---|---|
| PubChem CID | 135753375 |
| Molecular Formula | C12H17N5O7 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-amino-9-(2-hydroxyethoxymethyl)-1H-purin-6-one;butanedioic acid |
| SMILES | Nc1nc2c(ncn2COCCO)c(=O)[nH]1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C8H11N5O3.C4H6O4/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14;5-3(6)1-2-4(7)8/h3,14H,1-2,4H2,(H3,9,11,12,15);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | XGAYWEMHCKLHNB-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 193.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|