C17H22N10O6 — CID 138393908
2-amino-9-[2-[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxymethoxy]ethoxymethyl]-1H-purin-6-one (PubChem CID 138393908) has the molecular formula C17H22N10O6 and a molecular weight of 462.43 g/mol. Its IUPAC name is 2-amino-9-[2-[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxymethoxy]ethoxymethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxymethoxy]ethoxymethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 138393908 |
| Molecular Formula | C17H22N10O6 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-amino-9-[2-[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxymethoxy]ethoxymethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2COCCOCOCCOCn2cnc3c(=O)[nH]c(N)nc32)c(=O)[nH]1 |
| InChI | InChI=1S/C17H22N10O6/c18-16-22-12-10(14(28)24-16)20-5-26(12)7-30-1-3-32-9-33-4-2-31-8-27-6-21-11-13(27)23-17(19)25-15(11)29/h5-6H,1-4,7-9H2,(H3,18,22,24,28)(H3,19,23,25,29) |
| InChIKey | JJFFDXJGVPFUQM-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 216.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|