C9H15N6O5P — CID 135992380
2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-N-methylphosphonamidic acid (PubChem CID 135992380) has the molecular formula C9H15N6O5P and a molecular weight of 318.23 g/mol. Its IUPAC name is 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-N-methylphosphonamidic acid.
| Compound Name | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-N-methylphosphonamidic acid |
|---|---|
| PubChem CID | 135992380 |
| Molecular Formula | C9H15N6O5P |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-N-methylphosphonamidic acid |
| SMILES | CNP(=O)(O)OCCOCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C9H15N6O5P/c1-11-21(17,18)20-3-2-19-5-15-4-12-6-7(15)13-9(10)14-8(6)16/h4H,2-3,5H2,1H3,(H2,11,17,18)(H3,10,13,14,16) |
| InChIKey | XEKVCWGCEIBZRZ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|