C11H16F2N5O5P — CID 142625056
[5-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,1-difluoropentan-3-yl]phosphonic acid (PubChem CID 142625056) has the molecular formula C11H16F2N5O5P and a molecular weight of 367.25 g/mol. Its IUPAC name is [5-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,1-difluoropentan-3-yl]phosphonic acid.
| Compound Name | [5-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,1-difluoropentan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 142625056 |
| Molecular Formula | C11H16F2N5O5P |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | [5-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-1,1-difluoropentan-3-yl]phosphonic acid |
| SMILES | Nc1nc2c(ncn2COCCC(CC(F)F)P(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H16F2N5O5P/c12-7(13)3-6(24(20,21)22)1-2-23-5-18-4-15-8-9(18)16-11(14)17-10(8)19/h4,6-7H,1-3,5H2,(H2,20,21,22)(H3,14,16,17,19) |
| InChIKey | LEECVGBSCMADEZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|