C10H15FN5O6P — CID 135446907
[2-(2-amino-6-oxo-1H-purin-9-yl)-1-(2-fluoroethoxy)ethoxy]methylphosphonic acid (PubChem CID 135446907) has the molecular formula C10H15FN5O6P and a molecular weight of 351.23 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)-1-(2-fluoroethoxy)ethoxy]methylphosphonic acid.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)-1-(2-fluoroethoxy)ethoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 135446907 |
| Molecular Formula | C10H15FN5O6P |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)-1-(2-fluoroethoxy)ethoxy]methylphosphonic acid |
| SMILES | Nc1nc2c(ncn2CC(OCCF)OCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15FN5O6P/c11-1-2-21-6(22-5-23(18,19)20)3-16-4-13-7-8(16)14-10(12)15-9(7)17/h4,6H,1-3,5H2,(H2,18,19,20)(H3,12,14,15,17) |
| InChIKey | RGXRFRCAGBMABW-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|