C9H18N5O12P3 — CID 136602085
[(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethylphosphonic acid;phosphono dihydrogen phosphate (PubChem CID 136602085) has the molecular formula C9H18N5O12P3 and a molecular weight of 481.19 g/mol. Its IUPAC name is [(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethylphosphonic acid;phosphono dihydrogen phosphate.
| Compound Name | [(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethylphosphonic acid;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 136602085 |
| Molecular Formula | C9H18N5O12P3 |
| Molecular Weight | 481.19 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | [(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethylphosphonic acid;phosphono dihydrogen phosphate |
| SMILES | C[C@H](Cn1cnc2c(=O)[nH]c(N)nc21)OCP(=O)(O)O.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C9H14N5O5P.H4O7P2/c1-5(19-4-20(16,17)18)2-14-3-11-6-7(14)12-9(10)13-8(6)15;1-8(2,3)7-9(4,5)6/h3,5H,2,4H2,1H3,(H2,16,17,18)(H3,10,12,13,15);(H2,1,2,3)(H2,4,5,6)/t5-;/m1./s1 |
| InChIKey | RKPMTOSELYLSLE-NUBCRITNSA-N |
| XLogP | -1.57 |
| TPSA | 280.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.19 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|