C13H23N6O4P — CID 10948316
[(2R)-1-[2-amino-6-(2-methylpropylamino)purin-9-yl]propan-2-yl]oxymethylphosphonic acid (PubChem CID 10948316) has the molecular formula C13H23N6O4P and a molecular weight of 358.34 g/mol. Its IUPAC name is [(2R)-1-[2-amino-6-(2-methylpropylamino)purin-9-yl]propan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R)-1-[2-amino-6-(2-methylpropylamino)purin-9-yl]propan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 10948316 |
| Molecular Formula | C13H23N6O4P |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [(2R)-1-[2-amino-6-(2-methylpropylamino)purin-9-yl]propan-2-yl]oxymethylphosphonic acid |
| SMILES | CC(C)CNc1nc(N)nc2c1ncn2C[C@@H](C)OCP(=O)(O)O |
| InChI | InChI=1S/C13H23N6O4P/c1-8(2)4-15-11-10-12(18-13(14)17-11)19(6-16-10)5-9(3)23-7-24(20,21)22/h6,8-9H,4-5,7H2,1-3H3,(H2,20,21,22)(H3,14,15,17,18)/t9-/m1/s1 |
| InChIKey | CDHDRQBPBPIREE-SECBINFHSA-N |
| XLogP | 1.02 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|