C12H23N7O4P+ — CID 512308
[3-(2,6-diaminopurin-9-yl)-2-(phosphonomethoxy)propyl]-trimethylazanium (PubChem CID 512308) has the molecular formula C12H23N7O4P+ and a molecular weight of 360.34 g/mol. Its IUPAC name is [3-(2,6-diaminopurin-9-yl)-2-(phosphonomethoxy)propyl]-trimethylazanium.
| Compound Name | [3-(2,6-diaminopurin-9-yl)-2-(phosphonomethoxy)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 512308 |
| Molecular Formula | C12H23N7O4P+ |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [3-(2,6-diaminopurin-9-yl)-2-(phosphonomethoxy)propyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(Cn1cnc2c(N)nc(N)nc21)OCP(=O)(O)O |
| InChI | InChI=1S/C12H22N7O4P/c1-19(2,3)5-8(23-7-24(20,21)22)4-18-6-15-9-10(13)16-12(14)17-11(9)18/h6,8H,4-5,7H2,1-3H3,(H5-,13,14,16,17,20,21,22)/p+1 |
| InChIKey | RZYZIWWFICZRPO-UHFFFAOYSA-O |
| XLogP | -0.78 |
| TPSA | 162.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|