C10H16FN6O5P — CID 3010212
[2-(2,6-diaminopurin-9-yl)-1-(2-fluoroethoxy)ethoxy]methylphosphonic acid (PubChem CID 3010212) has the molecular formula C10H16FN6O5P and a molecular weight of 350.25 g/mol. Its IUPAC name is [2-(2,6-diaminopurin-9-yl)-1-(2-fluoroethoxy)ethoxy]methylphosphonic acid.
| Compound Name | [2-(2,6-diaminopurin-9-yl)-1-(2-fluoroethoxy)ethoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 3010212 |
| Molecular Formula | C10H16FN6O5P |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [2-(2,6-diaminopurin-9-yl)-1-(2-fluoroethoxy)ethoxy]methylphosphonic acid |
| SMILES | Nc1nc(N)c2ncn(CC(OCCF)OCP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C10H16FN6O5P/c11-1-2-21-6(22-5-23(18,19)20)3-17-4-14-7-8(12)15-10(13)16-9(7)17/h4,6H,1-3,5H2,(H2,18,19,20)(H4,12,13,15,16) |
| InChIKey | UQTWIANLPABPSX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 171.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|