C9H14FN6OP — CID 68817309
9-[(2S)-3-fluoro-2-(phosphanylmethoxy)propyl]purine-2,6-diamine (PubChem CID 68817309) has the molecular formula C9H14FN6OP and a molecular weight of 272.22 g/mol. Its IUPAC name is 9-[(2S)-3-fluoro-2-(phosphanylmethoxy)propyl]purine-2,6-diamine.
| Compound Name | 9-[(2S)-3-fluoro-2-(phosphanylmethoxy)propyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 68817309 |
| Molecular Formula | C9H14FN6OP |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 9-[(2S)-3-fluoro-2-(phosphanylmethoxy)propyl]purine-2,6-diamine |
| SMILES | Nc1nc(N)c2ncn(C[C@@H](CF)OCP)c2n1 |
| InChI | InChI=1S/C9H14FN6OP/c10-1-5(17-4-18)2-16-3-13-6-7(11)14-9(12)15-8(6)16/h3,5H,1-2,4,18H2,(H4,11,12,14,15)/t5-/m1/s1 |
| InChIKey | ZATFNGCHPJBKRC-RXMQYKEDSA-N |
| XLogP | 0.18 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|