C10H16N6O — CID 163571544
9-[(2S)-3-methoxy-2-methylpropyl]purine-2,6-diamine (PubChem CID 163571544) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is 9-[(2S)-3-methoxy-2-methylpropyl]purine-2,6-diamine.
| Compound Name | 9-[(2S)-3-methoxy-2-methylpropyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 163571544 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 9-[(2S)-3-methoxy-2-methylpropyl]purine-2,6-diamine |
| SMILES | COC[C@@H](C)Cn1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C10H16N6O/c1-6(4-17-2)3-16-5-13-7-8(11)14-10(12)15-9(7)16/h5-6H,3-4H2,1-2H3,(H4,11,12,14,15)/t6-/m0/s1 |
| InChIKey | FZTGTVMJFNOQDT-LURJTMIESA-N |
| XLogP | 0.27 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |