C9H14N6O2 — CID 143078293
2-[2-(2,6-diaminopurin-9-yl)ethoxy]ethanol (PubChem CID 143078293) has the molecular formula C9H14N6O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-[2-(2,6-diaminopurin-9-yl)ethoxy]ethanol.
| Compound Name | 2-[2-(2,6-diaminopurin-9-yl)ethoxy]ethanol |
|---|---|
| PubChem CID | 143078293 |
| Molecular Formula | C9H14N6O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-[2-(2,6-diaminopurin-9-yl)ethoxy]ethanol |
| SMILES | Nc1nc(N)c2ncn(CCOCCO)c2n1 |
| InChI | InChI=1S/C9H14N6O2/c10-7-6-8(14-9(11)13-7)15(5-12-6)1-3-17-4-2-16/h5,16H,1-4H2,(H4,10,11,13,14) |
| InChIKey | NZRJMALWGJLKQF-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|