C8H14Cl2N6 — CID 141031131
9-propylpurine-2,6-diamine;dihydrochloride (PubChem CID 141031131) has the molecular formula C8H14Cl2N6 and a molecular weight of 265.15 g/mol. Its IUPAC name is 9-propylpurine-2,6-diamine;dihydrochloride.
| Compound Name | 9-propylpurine-2,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 141031131 |
| Molecular Formula | C8H14Cl2N6 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 9-propylpurine-2,6-diamine;dihydrochloride |
| SMILES | CCCn1cnc2c(N)nc(N)nc21.Cl.Cl |
| InChI | InChI=1S/C8H12N6.2ClH/c1-2-3-14-4-11-5-6(9)12-8(10)13-7(5)14;;/h4H,2-3H2,1H3,(H4,9,10,12,13);2*1H |
| InChIKey | LPFBQQFFQHZGQC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |