C10H20N7O4P — CID 10688070
azanium 2-(2,6-diaminopurin-9-yl)ethoxymethyl-ethoxyphosphinate (PubChem CID 10688070) has the molecular formula C10H20N7O4P and a molecular weight of 333.29 g/mol. Its IUPAC name is azanium 2-(2,6-diaminopurin-9-yl)ethoxymethyl-ethoxyphosphinate.
| Compound Name | azanium 2-(2,6-diaminopurin-9-yl)ethoxymethyl-ethoxyphosphinate |
|---|---|
| PubChem CID | 10688070 |
| Molecular Formula | C10H20N7O4P |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | azanium 2-(2,6-diaminopurin-9-yl)ethoxymethyl-ethoxyphosphinate |
| SMILES | CCOP(=O)([O-])COCCn1cnc2c(N)nc(N)nc21.[NH4+] |
| InChI | InChI=1S/C10H17N6O4P.H3N/c1-2-20-21(17,18)6-19-4-3-16-5-13-7-8(11)14-10(12)15-9(7)16;/h5H,2-4,6H2,1H3,(H,17,18)(H4,11,12,14,15);1H3 |
| InChIKey | OKRKSKSYWMCKGS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 190.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|