C18H24N5O5PS — CID 24888133
2-[2-amino-6-(4-butoxyphenyl)sulfanylpurin-9-yl]ethoxymethylphosphonic acid (PubChem CID 24888133) has the molecular formula C18H24N5O5PS and a molecular weight of 453.46 g/mol. Its IUPAC name is 2-[2-amino-6-(4-butoxyphenyl)sulfanylpurin-9-yl]ethoxymethylphosphonic acid.
| Compound Name | 2-[2-amino-6-(4-butoxyphenyl)sulfanylpurin-9-yl]ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 24888133 |
| Molecular Formula | C18H24N5O5PS |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-[2-amino-6-(4-butoxyphenyl)sulfanylpurin-9-yl]ethoxymethylphosphonic acid |
| SMILES | CCCCOc1ccc(Sc2nc(N)nc3c2ncn3CCOCP(=O)(O)O)cc1 |
| InChI | InChI=1S/C18H24N5O5PS/c1-2-3-9-28-13-4-6-14(7-5-13)30-17-15-16(21-18(19)22-17)23(11-20-15)8-10-27-12-29(24,25)26/h4-7,11H,2-3,8-10,12H2,1H3,(H2,19,21,22)(H2,24,25,26) |
| InChIKey | MMTUOLQEDLBXNJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|