C21H25F6N5O6P2S — CID 24886714
[1-[2-amino-6-(4-ethoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxy-[hydroxy(2,2,2-trifluoroethyl)phosphoryl]methyl]-(2,2,2-trifluoroethyl)phosphinic acid (PubChem CID 24886714) has the molecular formula C21H25F6N5O6P2S and a molecular weight of 651.46 g/mol. Its IUPAC name is [1-[2-amino-6-(4-ethoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxy-[hydroxy(2,2,2-trifluoroethyl)phosphoryl]methyl]-(2,2,2-trifluoroethyl)phosphinic acid.
| Compound Name | [1-[2-amino-6-(4-ethoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxy-[hydroxy(2,2,2-trifluoroethyl)phosphoryl]methyl]-(2,2,2-trifluoroethyl)phosphinic acid |
|---|---|
| PubChem CID | 24886714 |
| Molecular Formula | C21H25F6N5O6P2S |
| Molecular Weight | 651.46 g/mol |
| Exact Mass | 651.09 |
| IUPAC Name | [1-[2-amino-6-(4-ethoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxy-[hydroxy(2,2,2-trifluoroethyl)phosphoryl]methyl]-(2,2,2-trifluoroethyl)phosphinic acid |
| SMILES | CCOc1ccc(Sc2nc(N)nc3c2ncn3CC(C)OC(P(=O)(O)CC(F)(F)F)P(=O)(O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H25F6N5O6P2S/c1-3-37-13-4-6-14(7-5-13)41-17-15-16(30-18(28)31-17)32(11-29-15)8-12(2)38-19(39(33,34)9-20(22,23)24)40(35,36)10-21(25,26)27/h4-7,11-12,19H,3,8-10H2,1-2H3,(H,33,34)(H,35,36)(H2,28,30,31) |
| InChIKey | PMKKHIAQJQEXGF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|