C20H22F6N5O2PS2 — CID 141250483
9-[2-[bis(2,2,2-trifluoroethyl)phosphorylmethoxy]propyl]-6-(2-methylsulfanylphenyl)sulfanylpurin-2-amine (PubChem CID 141250483) has the molecular formula C20H22F6N5O2PS2 and a molecular weight of 573.53 g/mol. Its IUPAC name is 9-[2-[bis(2,2,2-trifluoroethyl)phosphorylmethoxy]propyl]-6-(2-methylsulfanylphenyl)sulfanylpurin-2-amine.
| Compound Name | 9-[2-[bis(2,2,2-trifluoroethyl)phosphorylmethoxy]propyl]-6-(2-methylsulfanylphenyl)sulfanylpurin-2-amine |
|---|---|
| PubChem CID | 141250483 |
| Molecular Formula | C20H22F6N5O2PS2 |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | 9-[2-[bis(2,2,2-trifluoroethyl)phosphorylmethoxy]propyl]-6-(2-methylsulfanylphenyl)sulfanylpurin-2-amine |
| SMILES | CSc1ccccc1Sc1nc(N)nc2c1ncn2CC(C)OCP(=O)(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C20H22F6N5O2PS2/c1-12(33-11-34(32,8-19(21,22)23)9-20(24,25)26)7-31-10-28-15-16(31)29-18(27)30-17(15)36-14-6-4-3-5-13(14)35-2/h3-6,10,12H,7-9,11H2,1-2H3,(H2,27,29,30) |
| InChIKey | GTZNJXGTBUKQPY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|