C26H36N5O9PS — CID 53246344
[1-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-(2-methylpropanoyloxymethoxy)phosphoryl]oxymethyl 2-methylpropanoate (PubChem CID 53246344) has the molecular formula C26H36N5O9PS and a molecular weight of 625.64 g/mol. Its IUPAC name is [1-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-(2-methylpropanoyloxymethoxy)phosphoryl]oxymethyl 2-methylpropanoate.
| Compound Name | [1-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-(2-methylpropanoyloxymethoxy)phosphoryl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 53246344 |
| Molecular Formula | C26H36N5O9PS |
| Molecular Weight | 625.64 g/mol |
| Exact Mass | 625.20 |
| IUPAC Name | [1-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-(2-methylpropanoyloxymethoxy)phosphoryl]oxymethyl 2-methylpropanoate |
| SMILES | COc1ccc(Sc2nc(N)nc3c2ncn3CC(C)OCP(=O)(OCOC(=O)C(C)C)OCOC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C26H36N5O9PS/c1-16(2)24(32)36-13-39-41(34,40-14-37-25(33)17(3)4)15-38-18(5)11-31-12-28-21-22(31)29-26(27)30-23(21)42-20-9-7-19(35-6)8-10-20/h7-10,12,16-18H,11,13-15H2,1-6H3,(H2,27,29,30) |
| InChIKey | HTQXIYPGYWOACE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 176.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|