C14H24N5O6P — CID 144858442
[(2R)-1-(2-amino-6-methoxypurin-9-yl)propan-2-yl]oxymethyl-(3-methoxypropoxy)phosphinic acid (PubChem CID 144858442) has the molecular formula C14H24N5O6P and a molecular weight of 389.35 g/mol. Its IUPAC name is [(2R)-1-(2-amino-6-methoxypurin-9-yl)propan-2-yl]oxymethyl-(3-methoxypropoxy)phosphinic acid.
| Compound Name | [(2R)-1-(2-amino-6-methoxypurin-9-yl)propan-2-yl]oxymethyl-(3-methoxypropoxy)phosphinic acid |
|---|---|
| PubChem CID | 144858442 |
| Molecular Formula | C14H24N5O6P |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [(2R)-1-(2-amino-6-methoxypurin-9-yl)propan-2-yl]oxymethyl-(3-methoxypropoxy)phosphinic acid |
| SMILES | COCCCOP(=O)(O)CO[C@H](C)Cn1cnc2c(OC)nc(N)nc21 |
| InChI | InChI=1S/C14H24N5O6P/c1-10(24-9-26(20,21)25-6-4-5-22-2)7-19-8-16-11-12(19)17-14(15)18-13(11)23-3/h8,10H,4-7,9H2,1-3H3,(H,20,21)(H2,15,17,18)/t10-/m1/s1 |
| InChIKey | HRAGRNHCFGCDJX-SNVBAGLBSA-N |
| XLogP | 1.02 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|