C13H21ClN5O4P — CID 118462107
6-chloro-9-[(2R)-2-(diethoxyphosphorylmethoxy)propyl]purin-2-amine (PubChem CID 118462107) has the molecular formula C13H21ClN5O4P and a molecular weight of 377.77 g/mol. Its IUPAC name is 6-chloro-9-[(2R)-2-(diethoxyphosphorylmethoxy)propyl]purin-2-amine.
| Compound Name | 6-chloro-9-[(2R)-2-(diethoxyphosphorylmethoxy)propyl]purin-2-amine |
|---|---|
| PubChem CID | 118462107 |
| Molecular Formula | C13H21ClN5O4P |
| Molecular Weight | 377.77 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 6-chloro-9-[(2R)-2-(diethoxyphosphorylmethoxy)propyl]purin-2-amine |
| SMILES | CCOP(=O)(CO[C@H](C)Cn1cnc2c(Cl)nc(N)nc21)OCC |
| InChI | InChI=1S/C13H21ClN5O4P/c1-4-22-24(20,23-5-2)8-21-9(3)6-19-7-16-10-11(14)17-13(15)18-12(10)19/h7,9H,4-6,8H2,1-3H3,(H2,15,17,18)/t9-/m1/s1 |
| InChIKey | SSMKXSRFIGCVPX-SECBINFHSA-N |
| XLogP | 2.69 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.77 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|