C15H25ClN5O2P — CID 141106992
6-chloro-9-[3-[di(propan-2-yl)phosphorylmethoxy]propyl]purin-2-amine (PubChem CID 141106992) has the molecular formula C15H25ClN5O2P and a molecular weight of 373.83 g/mol. Its IUPAC name is 6-chloro-9-[3-[di(propan-2-yl)phosphorylmethoxy]propyl]purin-2-amine.
| Compound Name | 6-chloro-9-[3-[di(propan-2-yl)phosphorylmethoxy]propyl]purin-2-amine |
|---|---|
| PubChem CID | 141106992 |
| Molecular Formula | C15H25ClN5O2P |
| Molecular Weight | 373.83 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 6-chloro-9-[3-[di(propan-2-yl)phosphorylmethoxy]propyl]purin-2-amine |
| SMILES | CC(C)P(=O)(COCCCn1cnc2c(Cl)nc(N)nc21)C(C)C |
| InChI | InChI=1S/C15H25ClN5O2P/c1-10(2)24(22,11(3)4)9-23-7-5-6-21-8-18-12-13(16)19-15(17)20-14(12)21/h8,10-11H,5-7,9H2,1-4H3,(H2,17,19,20) |
| InChIKey | FAKBMBJUVHVQBU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|