C10H14ClN5O2 — CID 10516417
2-[2-(2-amino-6-chloropurin-9-yl)ethyl](114C)propane-1,3-diol (PubChem CID 10516417) has the molecular formula C10H14ClN5O2 and a molecular weight of 273.70 g/mol. Its IUPAC name is 2-[2-(2-amino-6-chloropurin-9-yl)ethyl](114C)propane-1,3-diol.
| Compound Name | 2-[2-(2-amino-6-chloropurin-9-yl)ethyl](114C)propane-1,3-diol |
|---|---|
| PubChem CID | 10516417 |
| Molecular Formula | C10H14ClN5O2 |
| Molecular Weight | 273.70 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-[2-(2-amino-6-chloropurin-9-yl)ethyl](114C)propane-1,3-diol |
| SMILES | Nc1nc(Cl)c2ncn(CCC(CO)[14CH2]O)c2n1 |
| InChI | InChI=1S/C10H14ClN5O2/c11-8-7-9(15-10(12)14-8)16(5-13-7)2-1-6(3-17)4-18/h5-6,17-18H,1-4H2,(H2,12,14,15)/i3+2 |
| InChIKey | FSJCDRZLIWVLEH-YZRHJBSPSA-N |
| XLogP | 0.05 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.70 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |